C17H17N3O3S2 — CID 75403048
4-methoxy-2,6-dimethyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 75403048) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-methoxy-2,6-dimethyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75403048 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 4-methoxy-2,6-dimethyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)Nc2nc(-c3ccccn3)cs2)c(C)c1 |
| InChI | InChI=1S/C17H17N3O3S2/c1-11-8-13(23-3)9-12(2)16(11)25(21,22)20-17-19-15(10-24-17)14-6-4-5-7-18-14/h4-10H,1-3H3,(H,19,20) |
| InChIKey | FTJPALUJPDWRJD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|