C25H23N3O2S — CID 110492771
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 4-(4-methylphenyl)butanoate (PubChem CID 110492771) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 4-(4-methylphenyl)butanoate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 4-(4-methylphenyl)butanoate |
|---|---|
| PubChem CID | 110492771 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 4-(4-methylphenyl)butanoate |
| SMILES | Cc1ccc(CCCC(=O)Oc2cccc(Nc3nc(-c4ccccn4)cs3)c2)cc1 |
| InChI | InChI=1S/C25H23N3O2S/c1-18-11-13-19(14-12-18)6-4-10-24(29)30-21-8-5-7-20(16-21)27-25-28-23(17-31-25)22-9-2-3-15-26-22/h2-3,5,7-9,11-17H,4,6,10H2,1H3,(H,27,28) |
| InChIKey | APUWYHLDWHDLMA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|