C26H18N2O4 — CID 110494815
(2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-phenylmethoxybenzoate (PubChem CID 110494815) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-phenylmethoxybenzoate.
| Compound Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 110494815 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-phenylmethoxybenzoate |
| SMILES | O=C(Oc1ccc2nc(-c3ccccn3)oc2c1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H18N2O4/c29-26(19-9-11-20(12-10-19)30-17-18-6-2-1-3-7-18)31-21-13-14-22-24(16-21)32-25(28-22)23-8-4-5-15-27-23/h1-16H,17H2 |
| InChIKey | BUIMNYOZYJPOFZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|