C19H13N3O3 — CID 110494843
(2-pyridin-2-yl-1,3-benzoxazol-6-yl) 2-pyridin-4-ylacetate (PubChem CID 110494843) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 2-pyridin-4-ylacetate.
| Compound Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 2-pyridin-4-ylacetate |
|---|---|
| PubChem CID | 110494843 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 2-pyridin-4-ylacetate |
| SMILES | O=C(Cc1ccncc1)Oc1ccc2nc(-c3ccccn3)oc2c1 |
| InChI | InChI=1S/C19H13N3O3/c23-18(11-13-6-9-20-10-7-13)24-14-4-5-15-17(12-14)25-19(22-15)16-3-1-2-8-21-16/h1-10,12H,11H2 |
| InChIKey | USKWUKJGWVQYJV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|