C20H16N2O4S — CID 110504473
(2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-ethylbenzenesulfonate (PubChem CID 110504473) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-ethylbenzenesulfonate.
| Compound Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-ethylbenzenesulfonate |
|---|---|
| PubChem CID | 110504473 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-ethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)Oc2ccc3nc(-c4ccccn4)oc3c2)cc1 |
| InChI | InChI=1S/C20H16N2O4S/c1-2-14-6-9-16(10-7-14)27(23,24)26-15-8-11-17-19(13-15)25-20(22-17)18-5-3-4-12-21-18/h3-13H,2H2,1H3 |
| InChIKey | NRWBBPCBBYRENP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|