C14H10ClNO4S — CID 110504429
(2-methyl-1,3-benzoxazol-6-yl) 4-chlorobenzenesulfonate (PubChem CID 110504429) has the molecular formula C14H10ClNO4S and a molecular weight of 323.76 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-6-yl) 4-chlorobenzenesulfonate.
| Compound Name | (2-methyl-1,3-benzoxazol-6-yl) 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 110504429 |
| Molecular Formula | C14H10ClNO4S |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-6-yl) 4-chlorobenzenesulfonate |
| SMILES | Cc1nc2ccc(OS(=O)(=O)c3ccc(Cl)cc3)cc2o1 |
| InChI | InChI=1S/C14H10ClNO4S/c1-9-16-13-7-4-11(8-14(13)19-9)20-21(17,18)12-5-2-10(15)3-6-12/h2-8H,1H3 |
| InChIKey | XLNHMJLHNAUGEM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|