C15H11ClN2O5S — CID 88845141
methyl 6-(4-chlorophenyl)sulfonyloxy-1H-benzimidazole-2-carboxylate (PubChem CID 88845141) has the molecular formula C15H11ClN2O5S and a molecular weight of 366.78 g/mol. Its IUPAC name is methyl 6-(4-chlorophenyl)sulfonyloxy-1H-benzimidazole-2-carboxylate.
| Compound Name | methyl 6-(4-chlorophenyl)sulfonyloxy-1H-benzimidazole-2-carboxylate |
|---|---|
| PubChem CID | 88845141 |
| Molecular Formula | C15H11ClN2O5S |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | methyl 6-(4-chlorophenyl)sulfonyloxy-1H-benzimidazole-2-carboxylate |
| SMILES | COC(=O)c1nc2ccc(OS(=O)(=O)c3ccc(Cl)cc3)cc2[nH]1 |
| InChI | InChI=1S/C15H11ClN2O5S/c1-22-15(19)14-17-12-7-4-10(8-13(12)18-14)23-24(20,21)11-5-2-9(16)3-6-11/h2-8H,1H3,(H,17,18) |
| InChIKey | RJQZEITZYJXEPT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|