About (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate
(3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate (PubChem CID 23347918) has the molecular formula C15H11Cl2N3O5S
and a molecular weight of 416.24 g/mol. Its IUPAC name is (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate |
| PubChem CID | 23347918 |
| Molecular Formula | C15H11Cl2N3O5S |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate |
| SMILES | COC(=O)Nc1nc2ccc(S(=O)(=O)Oc3cc(Cl)cc(Cl)c3)cc2[nH]1 |
| InChI | InChI=1S/C15H11Cl2N3O5S/c1-24-15(21)20-14-18-12-3-2-11(7-13(12)19-14)26(22,23)25-10-5-8(16)4-9(17)6-10/h2-7H,1H3,(H2,18,19,20,21) |
| InChIKey | BYGWCYMTSFEQLM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate?
The IUPAC name of (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate (CID 23347918) is (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate.
What is the SMILES notation for (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate?
The canonical SMILES for (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate is COC(=O)Nc1nc2ccc(S(=O)(=O)Oc3cc(Cl)cc(Cl)c3)cc2[nH]1.
What is the InChIKey of (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate?
The InChIKey is BYGWCYMTSFEQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2N3O5S/c1-24-15(21)20-14-18-12-3-2-11(7-13(12)19-14)26(22,23)25-10-5-8(16)4-9(17)6-10/h2-7H,1H3,(H2,18,19,20,21).
What are the key properties of (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate?
(3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate has a molecular weight of 416.24 g/mol, XLogP of 3.82, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate is sourced from PubChem (CID 23347918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).