C16H14ClN3O5S — CID 23347988
(2-chloro-6-methylphenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate (PubChem CID 23347988) has the molecular formula C16H14ClN3O5S and a molecular weight of 395.82 g/mol. Its IUPAC name is (2-chloro-6-methylphenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate.
| Compound Name | (2-chloro-6-methylphenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate |
|---|---|
| PubChem CID | 23347988 |
| Molecular Formula | C16H14ClN3O5S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | (2-chloro-6-methylphenyl) 2-(methoxycarbonylamino)-3H-benzimidazole-5-sulfonate |
| SMILES | COC(=O)Nc1nc2ccc(S(=O)(=O)Oc3c(C)cccc3Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H14ClN3O5S/c1-9-4-3-5-11(17)14(9)25-26(22,23)10-6-7-12-13(8-10)19-15(18-12)20-16(21)24-2/h3-8H,1-2H3,(H2,18,19,20,21) |
| InChIKey | IGESXLVCVIMMAP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|