C20H24N4O5S — CID 173300178
methyl N-[6-[(1S)-1-(2-hydroxy-3-methylanilino)-2-methylpropyl]sulfonyl-1H-benzimidazol-2-yl]carbamate (PubChem CID 173300178) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is methyl N-[6-[(1S)-1-(2-hydroxy-3-methylanilino)-2-methylpropyl]sulfonyl-1H-benzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[6-[(1S)-1-(2-hydroxy-3-methylanilino)-2-methylpropyl]sulfonyl-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 173300178 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | methyl N-[6-[(1S)-1-(2-hydroxy-3-methylanilino)-2-methylpropyl]sulfonyl-1H-benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccc(S(=O)(=O)[C@H](Nc3cccc(C)c3O)C(C)C)cc2[nH]1 |
| InChI | InChI=1S/C20H24N4O5S/c1-11(2)18(21-15-7-5-6-12(3)17(15)25)30(27,28)13-8-9-14-16(10-13)23-19(22-14)24-20(26)29-4/h5-11,18,21,25H,1-4H3,(H2,22,23,24,26)/t18-/m0/s1 |
| InChIKey | NTSWSBSAFVYFBC-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|