C16H15N3O2S — CID 70629928
methyl N-[6-(2-methylphenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate (PubChem CID 70629928) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl N-[6-(2-methylphenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[6-(2-methylphenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 70629928 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | methyl N-[6-(2-methylphenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccc(Sc3ccccc3C)cc2[nH]1 |
| InChI | InChI=1S/C16H15N3O2S/c1-10-5-3-4-6-14(10)22-11-7-8-12-13(9-11)18-15(17-12)19-16(20)21-2/h3-9H,1-2H3,(H2,17,18,19,20) |
| InChIKey | AADGZDGWZHYYOI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |