C21H25N5O2S — CID 163265329
methyl N-[6-[4-(4-ethylpiperazin-1-yl)phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate (PubChem CID 163265329) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is methyl N-[6-[4-(4-ethylpiperazin-1-yl)phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[6-[4-(4-ethylpiperazin-1-yl)phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 163265329 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | methyl N-[6-[4-(4-ethylpiperazin-1-yl)phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate |
| SMILES | CCN1CCN(c2ccc(Sc3ccc4nc(NC(=O)OC)[nH]c4c3)cc2)CC1 |
| InChI | InChI=1S/C21H25N5O2S/c1-3-25-10-12-26(13-11-25)15-4-6-16(7-5-15)29-17-8-9-18-19(14-17)23-20(22-18)24-21(27)28-2/h4-9,14H,3,10-13H2,1-2H3,(H2,22,23,24,27) |
| InChIKey | MXLZRNVTQUJUEO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |