C15H21N3O2S2 — CID 10065812
methyl N-[5,6-bis(propylsulfanyl)-1H-benzimidazol-2-yl]carbamate (PubChem CID 10065812) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is methyl N-[5,6-bis(propylsulfanyl)-1H-benzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[5,6-bis(propylsulfanyl)-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 10065812 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl N-[5,6-bis(propylsulfanyl)-1H-benzimidazol-2-yl]carbamate |
| SMILES | CCCSc1cc2nc(NC(=O)OC)[nH]c2cc1SCCC |
| InChI | InChI=1S/C15H21N3O2S2/c1-4-6-21-12-8-10-11(9-13(12)22-7-5-2)17-14(16-10)18-15(19)20-3/h8-9H,4-7H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | AVFIKKRKKLANRS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |