C15H22N4OS2 — CID 165389323
2-amino-4-methylsulfanyl-N-(6-propylsulfanyl-1H-benzimidazol-2-yl)butanamide (PubChem CID 165389323) has the molecular formula C15H22N4OS2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-amino-4-methylsulfanyl-N-(6-propylsulfanyl-1H-benzimidazol-2-yl)butanamide.
| Compound Name | 2-amino-4-methylsulfanyl-N-(6-propylsulfanyl-1H-benzimidazol-2-yl)butanamide |
|---|---|
| PubChem CID | 165389323 |
| Molecular Formula | C15H22N4OS2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-amino-4-methylsulfanyl-N-(6-propylsulfanyl-1H-benzimidazol-2-yl)butanamide |
| SMILES | CCCSc1ccc2nc(NC(=O)C(N)CCSC)[nH]c2c1 |
| InChI | InChI=1S/C15H22N4OS2/c1-3-7-22-10-4-5-12-13(9-10)18-15(17-12)19-14(20)11(16)6-8-21-2/h4-5,9,11H,3,6-8,16H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | WLWSYGIHNMBBQI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |