C10H18N4OS — CID 103950165
(2S)-2-amino-N-(5-ethyl-1H-pyrazol-3-yl)-4-methylsulfanylbutanamide (PubChem CID 103950165) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is (2S)-2-amino-N-(5-ethyl-1H-pyrazol-3-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(5-ethyl-1H-pyrazol-3-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 103950165 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2S)-2-amino-N-(5-ethyl-1H-pyrazol-3-yl)-4-methylsulfanylbutanamide |
| SMILES | CCc1cc(NC(=O)[C@@H](N)CCSC)n[nH]1 |
| InChI | InChI=1S/C10H18N4OS/c1-3-7-6-9(14-13-7)12-10(15)8(11)4-5-16-2/h6,8H,3-5,11H2,1-2H3,(H2,12,13,14,15)/t8-/m0/s1 |
| InChIKey | WYKHWHYGHOGNMU-QMMMGPOBSA-N |
| XLogP | 0.99 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |