C9H13ClN4OS — CID 104893497
(2S)-2-amino-N-(2-chloropyrimidin-4-yl)-4-methylsulfanylbutanamide (PubChem CID 104893497) has the molecular formula C9H13ClN4OS and a molecular weight of 260.75 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-chloropyrimidin-4-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(2-chloropyrimidin-4-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104893497 |
| Molecular Formula | C9H13ClN4OS |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (2S)-2-amino-N-(2-chloropyrimidin-4-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C9H13ClN4OS/c1-16-5-3-6(11)8(15)13-7-2-4-12-9(10)14-7/h2,4,6H,3,5,11H2,1H3,(H,12,13,14,15)/t6-/m0/s1 |
| InChIKey | RFSOLFCESKJOFV-LURJTMIESA-N |
| XLogP | 1.15 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |