C9H9ClN4O — CID 116794976
2-amino-N-(2-chloropyrimidin-4-yl)pent-4-ynamide (PubChem CID 116794976) has the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. Its IUPAC name is 2-amino-N-(2-chloropyrimidin-4-yl)pent-4-ynamide.
| Compound Name | 2-amino-N-(2-chloropyrimidin-4-yl)pent-4-ynamide |
|---|---|
| PubChem CID | 116794976 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-amino-N-(2-chloropyrimidin-4-yl)pent-4-ynamide |
| SMILES | C#CCC(N)C(=O)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C9H9ClN4O/c1-2-3-6(11)8(15)13-7-4-5-12-9(10)14-7/h1,4-6H,3,11H2,(H,12,13,14,15) |
| InChIKey | OEMZMFGAJGVBBK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|