C30H26N6O4S2 — CID 23190345
methyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate (PubChem CID 23190345) has the molecular formula C30H26N6O4S2 and a molecular weight of 598.71 g/mol. Its IUPAC name is methyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate.
| Compound Name | methyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate |
|---|---|
| PubChem CID | 23190345 |
| Molecular Formula | C30H26N6O4S2 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | methyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate |
| SMILES | COC(=O)Nc1nc2ccc(Sc3ccccc3)cc2[nH]1.COC(=O)Nc1nc2ccc(Sc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/2C15H13N3O2S/c2*1-20-15(19)18-14-16-12-8-7-11(9-13(12)17-14)21-10-5-3-2-4-6-10/h2*2-9H,1H3,(H2,16,17,18,19) |
| InChIKey | XOEPZIQYLPNKRV-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |