C16H12N4O2S2 — CID 88846458
methyl N-[6-(3-thiocyanatophenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate (PubChem CID 88846458) has the molecular formula C16H12N4O2S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl N-[6-(3-thiocyanatophenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[6-(3-thiocyanatophenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 88846458 |
| Molecular Formula | C16H12N4O2S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | methyl N-[6-(3-thiocyanatophenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccc(Sc3cccc(SC#N)c3)cc2[nH]1 |
| InChI | InChI=1S/C16H12N4O2S2/c1-22-16(21)20-15-18-13-6-5-12(8-14(13)19-15)24-11-4-2-3-10(7-11)23-9-17/h2-8H,1H3,(H2,18,19,20,21) |
| InChIKey | FONDECPTEHYLOD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|