C21H23N5O3S — CID 169210882
methyl N-[6-[4-(4-acetylpiperazin-1-yl)phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate (PubChem CID 169210882) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is methyl N-[6-[4-(4-acetylpiperazin-1-yl)phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[6-[4-(4-acetylpiperazin-1-yl)phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 169210882 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | methyl N-[6-[4-(4-acetylpiperazin-1-yl)phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccc(Sc3ccc(N4CCN(C(C)=O)CC4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C21H23N5O3S/c1-14(27)25-9-11-26(12-10-25)15-3-5-16(6-4-15)30-17-7-8-18-19(13-17)23-20(22-18)24-21(28)29-2/h3-8,13H,9-12H2,1-2H3,(H2,22,23,24,28) |
| InChIKey | KYZHCRDZQLFRIU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |