C16H15ClO3S — CID 110504269
5,6,7,8-tetrahydronaphthalen-2-yl 4-chlorobenzenesulfonate (PubChem CID 110504269) has the molecular formula C16H15ClO3S and a molecular weight of 322.81 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-2-yl 4-chlorobenzenesulfonate.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-2-yl 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 110504269 |
| Molecular Formula | C16H15ClO3S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-2-yl 4-chlorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)CCCC2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClO3S/c17-14-6-9-16(10-7-14)21(18,19)20-15-8-5-12-3-1-2-4-13(12)11-15/h5-11H,1-4H2 |
| InChIKey | CPZROVYPFYWNSG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|