C15H13ClO3S3 — CID 5011862
[4-(1,3-dithiolan-2-yl)phenyl] 4-chlorobenzenesulfonate (PubChem CID 5011862) has the molecular formula C15H13ClO3S3 and a molecular weight of 372.92 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 5011862 |
| Molecular Formula | C15H13ClO3S3 |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2SCCS2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClO3S3/c16-12-3-7-14(8-4-12)22(17,18)19-13-5-1-11(2-6-13)15-20-9-10-21-15/h1-8,15H,9-10H2 |
| InChIKey | NNQKSXJESKGDRE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|