About 2-(4-chlorophenyl)-1,3-dithian-5-amine
2-(4-chlorophenyl)-1,3-dithian-5-amine (PubChem CID 86118123) has the molecular formula C10H12ClNS2
and a molecular weight of 245.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-dithian-5-amine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1,3-dithian-5-amine |
| PubChem CID | 86118123 |
| Molecular Formula | C10H12ClNS2 |
| Molecular Weight | 245.80 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-dithian-5-amine |
| SMILES | NC1CSC(c2ccc(Cl)cc2)SC1 |
| InChI | InChI=1S/C10H12ClNS2/c11-8-3-1-7(2-4-8)10-13-5-9(12)6-14-10/h1-4,9-10H,5-6,12H2 |
| InChIKey | QPVUWMVQGDSDMF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-1,3-dithian-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1,3-dithian-5-amine?
The IUPAC name of 2-(4-chlorophenyl)-1,3-dithian-5-amine (CID 86118123) is 2-(4-chlorophenyl)-1,3-dithian-5-amine.
What is the SMILES notation for 2-(4-chlorophenyl)-1,3-dithian-5-amine?
The canonical SMILES for 2-(4-chlorophenyl)-1,3-dithian-5-amine is NC1CSC(c2ccc(Cl)cc2)SC1.
What is the InChIKey of 2-(4-chlorophenyl)-1,3-dithian-5-amine?
The InChIKey is QPVUWMVQGDSDMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNS2/c11-8-3-1-7(2-4-8)10-13-5-9(12)6-14-10/h1-4,9-10H,5-6,12H2.
What are the key properties of 2-(4-chlorophenyl)-1,3-dithian-5-amine?
2-(4-chlorophenyl)-1,3-dithian-5-amine has a molecular weight of 245.80 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1,3-dithian-5-amine is sourced from PubChem (CID 86118123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).