C10H12ClNS2 — CID 86118123
2-(4-chlorophenyl)-1,3-dithian-5-amine (PubChem CID 86118123) has the molecular formula C10H12ClNS2 and a molecular weight of 245.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-dithian-5-amine.
| Compound Name | 2-(4-chlorophenyl)-1,3-dithian-5-amine |
|---|---|
| PubChem CID | 86118123 |
| Molecular Formula | C10H12ClNS2 |
| Molecular Weight | 245.80 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-dithian-5-amine |
| SMILES | NC1CSC(c2ccc(Cl)cc2)SC1 |
| InChI | InChI=1S/C10H12ClNS2/c11-8-3-1-7(2-4-8)10-13-5-9(12)6-14-10/h1-4,9-10H,5-6,12H2 |
| InChIKey | QPVUWMVQGDSDMF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |