C16H14Cl2S2 — CID 11210011
2,6-bis(4-chlorophenyl)-1,4-dithiane (PubChem CID 11210011) has the molecular formula C16H14Cl2S2 and a molecular weight of 341.33 g/mol. Its IUPAC name is 2,6-bis(4-chlorophenyl)-1,4-dithiane.
| Compound Name | 2,6-bis(4-chlorophenyl)-1,4-dithiane |
|---|---|
| PubChem CID | 11210011 |
| Molecular Formula | C16H14Cl2S2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2,6-bis(4-chlorophenyl)-1,4-dithiane |
| SMILES | Clc1ccc(C2CSCC(c3ccc(Cl)cc3)S2)cc1 |
| InChI | InChI=1S/C16H14Cl2S2/c17-13-5-1-11(2-6-13)15-9-19-10-16(20-15)12-3-7-14(18)8-4-12/h1-8,15-16H,9-10H2 |
| InChIKey | YHZQZFBHOWYUKC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |