C10H12ClNO — CID 125117368
(3R,4S)-4-(4-chlorophenyl)pyrrolidin-3-ol (PubChem CID 125117368) has the molecular formula C10H12ClNO and a molecular weight of 197.67 g/mol. Its IUPAC name is (3R,4S)-4-(4-chlorophenyl)pyrrolidin-3-ol.
| Compound Name | (3R,4S)-4-(4-chlorophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 125117368 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (3R,4S)-4-(4-chlorophenyl)pyrrolidin-3-ol |
| SMILES | O[C@H]1CNC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO/c11-8-3-1-7(2-4-8)9-5-12-6-10(9)13/h1-4,9-10,12-13H,5-6H2/t9-,10+/m1/s1 |
| InChIKey | ZQODSTYMINEEDI-ZJUUUORDSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |