C12H15ClO — CID 94503733
trans-(1S,2R)-2-(4-chlorophenyl)cyclohexan-1-ol (PubChem CID 94503733) has the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. Its IUPAC name is trans-(1S,2R)-2-(4-chlorophenyl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2R)-2-(4-chlorophenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 94503733 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | trans-(1S,2R)-2-(4-chlorophenyl)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClO/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14/h5-8,11-12,14H,1-4H2/t11-,12+/m1/s1 |
| InChIKey | IJTCXAWGMMJYLJ-NEPJUHHUSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |