C10H13ClN2 — CID 90167505
(3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-amine (PubChem CID 90167505) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is (3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 90167505 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (3S,4R)-4-(4-chlorophenyl)pyrrolidin-3-amine |
| SMILES | N[C@@H]1CNC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClN2/c11-8-3-1-7(2-4-8)9-5-13-6-10(9)12/h1-4,9-10,13H,5-6,12H2/t9-,10+/m0/s1 |
| InChIKey | WZZKKLWADRBBJA-VHSXEESVSA-N |
| XLogP | 1.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |