C12H19N3 — CID 129407390
(3R,4R)-4-[4-(dimethylamino)phenyl]pyrrolidin-3-amine (PubChem CID 129407390) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is (3R,4R)-4-[4-(dimethylamino)phenyl]pyrrolidin-3-amine.
| Compound Name | (3R,4R)-4-[4-(dimethylamino)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 129407390 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (3R,4R)-4-[4-(dimethylamino)phenyl]pyrrolidin-3-amine |
| SMILES | CN(C)c1ccc([C@@H]2CNC[C@@H]2N)cc1 |
| InChI | InChI=1S/C12H19N3/c1-15(2)10-5-3-9(4-6-10)11-7-14-8-12(11)13/h3-6,11-12,14H,7-8,13H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | RNFZKQZLZIBFTR-RYUDHWBXSA-N |
| XLogP | 0.77 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|