C13H17N3 — CID 129463067
(3R,4R)-4-[4-(dimethylamino)phenyl]pyrrolidine-3-carbonitrile (PubChem CID 129463067) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is (3R,4R)-4-[4-(dimethylamino)phenyl]pyrrolidine-3-carbonitrile.
| Compound Name | (3R,4R)-4-[4-(dimethylamino)phenyl]pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 129463067 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (3R,4R)-4-[4-(dimethylamino)phenyl]pyrrolidine-3-carbonitrile |
| SMILES | CN(C)c1ccc([C@@H]2CNC[C@@H]2C#N)cc1 |
| InChI | InChI=1S/C13H17N3/c1-16(2)12-5-3-10(4-6-12)13-9-15-8-11(13)7-14/h3-6,11,13,15H,8-9H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | NTSHXXPKQIWHED-AAEUAGOBSA-N |
| XLogP | 1.58 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|