C13H22Cl2N2 — CID 19390920
N,N-dimethyl-4-piperidin-4-ylaniline;dihydrochloride (PubChem CID 19390920) has the molecular formula C13H22Cl2N2 and a molecular weight of 277.24 g/mol. Its IUPAC name is N,N-dimethyl-4-piperidin-4-ylaniline;dihydrochloride.
| Compound Name | N,N-dimethyl-4-piperidin-4-ylaniline;dihydrochloride |
|---|---|
| PubChem CID | 19390920 |
| Molecular Formula | C13H22Cl2N2 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N,N-dimethyl-4-piperidin-4-ylaniline;dihydrochloride |
| SMILES | CN(C)c1ccc(C2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C13H20N2.2ClH/c1-15(2)13-5-3-11(4-6-13)12-7-9-14-10-8-12;;/h3-6,12,14H,7-10H2,1-2H3;2*1H |
| InChIKey | JPDNJYIUHQHAHR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|