C13H19N — CID 54506338
4-cyclopentyl-N,N-dimethylaniline (PubChem CID 54506338) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 4-cyclopentyl-N,N-dimethylaniline.
| Compound Name | 4-cyclopentyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54506338 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4-cyclopentyl-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2CCCC2)cc1 |
| InChI | InChI=1S/C13H19N/c1-14(2)13-9-7-12(8-10-13)11-5-3-4-6-11/h7-11H,3-6H2,1-2H3 |
| InChIKey | SXXOQLIRKNUZRJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|