C60H63N — CID 59838926
4-[(E)-2-(4-cyclohexylphenyl)ethenyl]-N,N-bis[4-[(E)-2-(4-cyclohexylphenyl)ethenyl]phenyl]aniline (PubChem CID 59838926) has the molecular formula C60H63N and a molecular weight of 798.17 g/mol. Its IUPAC name is 4-[(E)-2-(4-cyclohexylphenyl)ethenyl]-N,N-bis[4-[(E)-2-(4-cyclohexylphenyl)ethenyl]phenyl]aniline.
| Compound Name | 4-[(E)-2-(4-cyclohexylphenyl)ethenyl]-N,N-bis[4-[(E)-2-(4-cyclohexylphenyl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59838926 |
| Molecular Formula | C60H63N |
| Molecular Weight | 798.17 g/mol |
| Exact Mass | 797.50 |
| IUPAC Name | 4-[(E)-2-(4-cyclohexylphenyl)ethenyl]-N,N-bis[4-[(E)-2-(4-cyclohexylphenyl)ethenyl]phenyl]aniline |
| SMILES | C(=C/c1ccc(N(c2ccc(/C=C/c3ccc(C4CCCCC4)cc3)cc2)c2ccc(/C=C/c3ccc(C4CCCCC4)cc3)cc2)cc1)\c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C60H63N/c1-4-10-52(11-5-1)55-34-22-46(23-35-55)16-19-49-28-40-58(41-29-49)61(59-42-30-50(31-43-59)20-17-47-24-36-56(37-25-47)53-12-6-2-7-13-53)60-44-32-51(33-45-60)21-18-48-26-38-57(39-27-48)54-14-8-3-9-15-54/h16-45,52-54H,1-15H2/b19-16+,20-17+,21-18+ |
| InChIKey | XONPSQNUELHWHA-VNQRMFGESA-N |
| XLogP | 17.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.17 |
| LogP ≤ 5 | 17.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|