C12H18N2O2 — CID 82617230
4-(3,5-dimethoxyphenyl)pyrrolidin-3-amine (PubChem CID 82617230) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)pyrrolidin-3-amine.
| Compound Name | 4-(3,5-dimethoxyphenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 82617230 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)pyrrolidin-3-amine |
| SMILES | COc1cc(OC)cc(C2CNCC2N)c1 |
| InChI | InChI=1S/C12H18N2O2/c1-15-9-3-8(4-10(5-9)16-2)11-6-14-7-12(11)13/h3-5,11-12,14H,6-7,13H2,1-2H3 |
| InChIKey | NGLFJVFDGDQRHO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |