C12H18N2O — CID 129493439
(3S,4S)-4-(3-ethoxyphenyl)pyrrolidin-3-amine (PubChem CID 129493439) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (3S,4S)-4-(3-ethoxyphenyl)pyrrolidin-3-amine.
| Compound Name | (3S,4S)-4-(3-ethoxyphenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 129493439 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (3S,4S)-4-(3-ethoxyphenyl)pyrrolidin-3-amine |
| SMILES | CCOc1cccc([C@H]2CNC[C@H]2N)c1 |
| InChI | InChI=1S/C12H18N2O/c1-2-15-10-5-3-4-9(6-10)11-7-14-8-12(11)13/h3-6,11-12,14H,2,7-8,13H2,1H3/t11-,12-/m1/s1 |
| InChIKey | NBRKGCXYEGOJKJ-VXGBXAGGSA-N |
| XLogP | 1.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |