C13H19NO2 — CID 79365505
2-(3-ethoxyphenyl)oxan-3-amine (PubChem CID 79365505) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(3-ethoxyphenyl)oxan-3-amine.
| Compound Name | 2-(3-ethoxyphenyl)oxan-3-amine |
|---|---|
| PubChem CID | 79365505 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(3-ethoxyphenyl)oxan-3-amine |
| SMILES | CCOc1cccc(C2OCCCC2N)c1 |
| InChI | InChI=1S/C13H19NO2/c1-2-15-11-6-3-5-10(9-11)13-12(14)7-4-8-16-13/h3,5-6,9,12-13H,2,4,7-8,14H2,1H3 |
| InChIKey | WEGURTLDFMSTJM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |