C19H30N2O3 — CID 50956772
1-[2-(3-ethoxyphenoxy)ethyl]-4-(oxolan-2-ylmethyl)piperazine (PubChem CID 50956772) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[2-(3-ethoxyphenoxy)ethyl]-4-(oxolan-2-ylmethyl)piperazine.
| Compound Name | 1-[2-(3-ethoxyphenoxy)ethyl]-4-(oxolan-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 50956772 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[2-(3-ethoxyphenoxy)ethyl]-4-(oxolan-2-ylmethyl)piperazine |
| SMILES | CCOc1cccc(OCCN2CCN(CC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-2-22-17-5-3-6-18(15-17)24-14-12-20-8-10-21(11-9-20)16-19-7-4-13-23-19/h3,5-6,15,19H,2,4,7-14,16H2,1H3 |
| InChIKey | DBNNSPJQRWPGAR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |