C11H15FN2O — CID 82612413
4-(3-fluoro-4-methoxyphenyl)pyrrolidin-3-amine (PubChem CID 82612413) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 4-(3-fluoro-4-methoxyphenyl)pyrrolidin-3-amine.
| Compound Name | 4-(3-fluoro-4-methoxyphenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 82612413 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-(3-fluoro-4-methoxyphenyl)pyrrolidin-3-amine |
| SMILES | COc1ccc(C2CNCC2N)cc1F |
| InChI | InChI=1S/C11H15FN2O/c1-15-11-3-2-7(4-9(11)12)8-5-14-6-10(8)13/h2-4,8,10,14H,5-6,13H2,1H3 |
| InChIKey | CNNJJFFXGUMOQG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |