C12H17FN2O — CID 82391825
4-(3-fluoro-4-methoxyphenyl)-1-methylpyrrolidin-3-amine (PubChem CID 82391825) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 4-(3-fluoro-4-methoxyphenyl)-1-methylpyrrolidin-3-amine.
| Compound Name | 4-(3-fluoro-4-methoxyphenyl)-1-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 82391825 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-(3-fluoro-4-methoxyphenyl)-1-methylpyrrolidin-3-amine |
| SMILES | COc1ccc(C2CN(C)CC2N)cc1F |
| InChI | InChI=1S/C12H17FN2O/c1-15-6-9(11(14)7-15)8-3-4-12(16-2)10(13)5-8/h3-5,9,11H,6-7,14H2,1-2H3 |
| InChIKey | GIQXZMPOXHFYGR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |