C11H15FN2 — CID 96623121
(3S,4R)-4-(3-fluorophenyl)-1-methylpyrrolidin-3-amine (PubChem CID 96623121) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is (3S,4R)-4-(3-fluorophenyl)-1-methylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-(3-fluorophenyl)-1-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 96623121 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (3S,4R)-4-(3-fluorophenyl)-1-methylpyrrolidin-3-amine |
| SMILES | CN1C[C@@H](N)[C@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C11H15FN2/c1-14-6-10(11(13)7-14)8-3-2-4-9(12)5-8/h2-5,10-11H,6-7,13H2,1H3/t10-,11+/m0/s1 |
| InChIKey | ZHLDVCKYPVWQCG-WDEREUQCSA-N |
| XLogP | 1.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |