C13H20N2O2 — CID 96594536
(3S,4S)-4-(2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-amine (PubChem CID 96594536) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3S,4S)-4-(2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-amine.
| Compound Name | (3S,4S)-4-(2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 96594536 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (3S,4S)-4-(2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-amine |
| SMILES | COc1ccc([C@H]2CN(C)C[C@H]2N)c(OC)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-15-7-11(12(14)8-15)10-5-4-9(16-2)6-13(10)17-3/h4-6,11-12H,7-8,14H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | TUJBJQKETRTNLU-VXGBXAGGSA-N |
| XLogP | 1.06 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |