C23H33N3O4 — CID 20519799
1,2-bis[2-(2,4-dimethoxyphenyl)ethyl]pyrazolidin-4-amine (PubChem CID 20519799) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 1,2-bis[2-(2,4-dimethoxyphenyl)ethyl]pyrazolidin-4-amine.
| Compound Name | 1,2-bis[2-(2,4-dimethoxyphenyl)ethyl]pyrazolidin-4-amine |
|---|---|
| PubChem CID | 20519799 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1,2-bis[2-(2,4-dimethoxyphenyl)ethyl]pyrazolidin-4-amine |
| SMILES | COc1ccc(CCN2CC(N)CN2CCc2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C23H33N3O4/c1-27-20-7-5-17(22(13-20)29-3)9-11-25-15-19(24)16-26(25)12-10-18-6-8-21(28-2)14-23(18)30-4/h5-8,13-14,19H,9-12,15-16,24H2,1-4H3 |
| InChIKey | KDKXXTOBMUWVOF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |