C13H20N2O2 — CID 82621037
[4-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]methanamine (PubChem CID 82621037) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [4-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]methanamine.
| Compound Name | [4-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 82621037 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [4-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]methanamine |
| SMILES | COc1ccc(C2CNCC2CN)cc1OC |
| InChI | InChI=1S/C13H20N2O2/c1-16-12-4-3-9(5-13(12)17-2)11-8-15-7-10(11)6-14/h3-5,10-11,15H,6-8,14H2,1-2H3 |
| InChIKey | PROKGUTWCXJPKU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |