C14H21NO2 — CID 129407376
(4S)-4-(3,4-dimethoxyphenyl)-3,3-dimethylpyrrolidine (PubChem CID 129407376) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (4S)-4-(3,4-dimethoxyphenyl)-3,3-dimethylpyrrolidine.
| Compound Name | (4S)-4-(3,4-dimethoxyphenyl)-3,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 129407376 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (4S)-4-(3,4-dimethoxyphenyl)-3,3-dimethylpyrrolidine |
| SMILES | COc1ccc([C@@H]2CNCC2(C)C)cc1OC |
| InChI | InChI=1S/C14H21NO2/c1-14(2)9-15-8-11(14)10-5-6-12(16-3)13(7-10)17-4/h5-7,11,15H,8-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | KICKUSIXAKBFLG-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |