C11H17NO2 — CID 23170558
azane;4-cyclopropyl-1,2-dimethoxybenzene (PubChem CID 23170558) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is azane;4-cyclopropyl-1,2-dimethoxybenzene.
| Compound Name | azane;4-cyclopropyl-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 23170558 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | azane;4-cyclopropyl-1,2-dimethoxybenzene |
| SMILES | COc1ccc(C2CC2)cc1OC.N |
| InChI | InChI=1S/C11H14O2.H3N/c1-12-10-6-5-9(8-3-4-8)7-11(10)13-2;/h5-8H,3-4H2,1-2H3;1H3 |
| InChIKey | MGXDEEWETJJUQO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |