C20H24O5 — CID 13491508
2,5-bis(3,4-dimethoxyphenyl)oxolane (PubChem CID 13491508) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2,5-bis(3,4-dimethoxyphenyl)oxolane.
| Compound Name | 2,5-bis(3,4-dimethoxyphenyl)oxolane |
|---|---|
| PubChem CID | 13491508 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2,5-bis(3,4-dimethoxyphenyl)oxolane |
| SMILES | COc1ccc(C2CCC(c3ccc(OC)c(OC)c3)O2)cc1OC |
| InChI | InChI=1S/C20H24O5/c1-21-17-7-5-13(11-19(17)23-3)15-9-10-16(25-15)14-6-8-18(22-2)20(12-14)24-4/h5-8,11-12,15-16H,9-10H2,1-4H3 |
| InChIKey | QJCGZUKQWHTSOT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |