C14H20O4 — CID 142954682
(2S,5R)-2-methyl-5-(3,4,5-trimethoxyphenyl)oxolane (PubChem CID 142954682) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S,5R)-2-methyl-5-(3,4,5-trimethoxyphenyl)oxolane.
| Compound Name | (2S,5R)-2-methyl-5-(3,4,5-trimethoxyphenyl)oxolane |
|---|---|
| PubChem CID | 142954682 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2S,5R)-2-methyl-5-(3,4,5-trimethoxyphenyl)oxolane |
| SMILES | COc1cc([C@H]2CC[C@H](C)O2)cc(OC)c1OC |
| InChI | InChI=1S/C14H20O4/c1-9-5-6-11(18-9)10-7-12(15-2)14(17-4)13(8-10)16-3/h7-9,11H,5-6H2,1-4H3/t9-,11+/m0/s1 |
| InChIKey | SYPYNUBDMWFPSS-GXSJLCMTSA-N |
| XLogP | 2.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |