C23H29NO8 — CID 15390178
(2S,5S)-2-(3-methoxy-5-nitro-4-propoxyphenyl)-5-(3,4,5-trimethoxyphenyl)oxolane (PubChem CID 15390178) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is (2S,5S)-2-(3-methoxy-5-nitro-4-propoxyphenyl)-5-(3,4,5-trimethoxyphenyl)oxolane.
| Compound Name | (2S,5S)-2-(3-methoxy-5-nitro-4-propoxyphenyl)-5-(3,4,5-trimethoxyphenyl)oxolane |
|---|---|
| PubChem CID | 15390178 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (2S,5S)-2-(3-methoxy-5-nitro-4-propoxyphenyl)-5-(3,4,5-trimethoxyphenyl)oxolane |
| SMILES | CCCOc1c(OC)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H29NO8/c1-6-9-31-22-16(24(25)26)10-14(11-19(22)27-2)17-7-8-18(32-17)15-12-20(28-3)23(30-5)21(13-15)29-4/h10-13,17-18H,6-9H2,1-5H3/t17-,18-/m0/s1 |
| InChIKey | OCBCBSRSLBANPB-ROUUACIJSA-N |
| XLogP | 5.01 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|