C28H41NO8S — CID 18467384
3-[2-propoxy-3-propylsulfonyl-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-1-amine (PubChem CID 18467384) has the molecular formula C28H41NO8S and a molecular weight of 551.70 g/mol. Its IUPAC name is 3-[2-propoxy-3-propylsulfonyl-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-1-amine.
| Compound Name | 3-[2-propoxy-3-propylsulfonyl-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 18467384 |
| Molecular Formula | C28H41NO8S |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 3-[2-propoxy-3-propylsulfonyl-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-1-amine |
| SMILES | CCCOc1c(OCCCN)cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CCC |
| InChI | InChI=1S/C28H41NO8S/c1-6-12-36-28-25(35-13-8-11-29)17-20(18-26(28)38(30,31)14-7-2)22-10-9-21(37-22)19-15-23(32-3)27(34-5)24(16-19)33-4/h15-18,21-22H,6-14,29H2,1-5H3 |
| InChIKey | HWYOMUASXMOZMT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|