C29H43NO9S — CID 18642295
3-[3-[2-(dimethylamino)ethylsulfonyl]-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-1-ol (PubChem CID 18642295) has the molecular formula C29H43NO9S and a molecular weight of 581.73 g/mol. Its IUPAC name is 3-[3-[2-(dimethylamino)ethylsulfonyl]-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-1-ol.
| Compound Name | 3-[3-[2-(dimethylamino)ethylsulfonyl]-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 18642295 |
| Molecular Formula | C29H43NO9S |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 3-[3-[2-(dimethylamino)ethylsulfonyl]-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-1-ol |
| SMILES | CCCOc1c(OCCCO)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CCN(C)C |
| InChI | InChI=1S/C29H43NO9S/c1-7-13-38-29-26(37-14-8-12-31)18-21(19-27(29)40(32,33)15-11-30(2)3)23-10-9-22(39-23)20-16-24(34-4)28(36-6)25(17-20)35-5/h16-19,22-23,31H,7-15H2,1-6H3/t22-,23-/m0/s1 |
| InChIKey | ZEAUATZLKCEVAM-GOTSBHOMSA-N |
| XLogP | 4.19 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|