C36H43NO10S — CID 54341474
2-[3-[2-propoxy-3-propylsulfonyl-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 54341474) has the molecular formula C36H43NO10S and a molecular weight of 681.80 g/mol. Its IUPAC name is 2-[3-[2-propoxy-3-propylsulfonyl-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[2-propoxy-3-propylsulfonyl-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54341474 |
| Molecular Formula | C36H43NO10S |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 681.26 |
| IUPAC Name | 2-[3-[2-propoxy-3-propylsulfonyl-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | CCCOc1c(OCCCN2C(=O)c3ccccc3C2=O)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CCC |
| InChI | InChI=1S/C36H43NO10S/c1-6-16-46-34-31(45-17-10-15-37-35(38)25-11-8-9-12-26(25)36(37)39)21-24(22-32(34)48(40,41)18-7-2)28-14-13-27(47-28)23-19-29(42-3)33(44-5)30(20-23)43-4/h8-9,11-12,19-22,27-28H,6-7,10,13-18H2,1-5H3/t27-,28-/m0/s1 |
| InChIKey | TZGCBBSROILABQ-NSOVKSMOSA-N |
| XLogP | 6.34 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|